C16H20F3NO3 — CID 94678482
N-[(2R)-2-hydroxy-3-[4-(trifluoromethyl)phenoxy]propyl]cyclopentanecarboxamide (PubChem CID 94678482) has the molecular formula C16H20F3NO3 and a molecular weight of 331.33 g/mol. Its IUPAC name is N-[(2R)-2-hydroxy-3-[4-(trifluoromethyl)phenoxy]propyl]cyclopentanecarboxamide.
| Compound Name | N-[(2R)-2-hydroxy-3-[4-(trifluoromethyl)phenoxy]propyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 94678482 |
| Molecular Formula | C16H20F3NO3 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | N-[(2R)-2-hydroxy-3-[4-(trifluoromethyl)phenoxy]propyl]cyclopentanecarboxamide |
| SMILES | O=C(NC[C@@H](O)COc1ccc(C(F)(F)F)cc1)C1CCCC1 |
| InChI | InChI=1S/C16H20F3NO3/c17-16(18,19)12-5-7-14(8-6-12)23-10-13(21)9-20-15(22)11-3-1-2-4-11/h5-8,11,13,21H,1-4,9-10H2,(H,20,22)/t13-/m1/s1 |
| InChIKey | PCLWYNLJFCWPFU-CYBMUJFWSA-N |
| XLogP | 2.75 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |