C16H21F2NO3 — CID 111102881
N-[3-(3,4-difluorophenoxy)-2-hydroxypropyl]cyclohexanecarboxamide (PubChem CID 111102881) has the molecular formula C16H21F2NO3 and a molecular weight of 313.34 g/mol. Its IUPAC name is N-[3-(3,4-difluorophenoxy)-2-hydroxypropyl]cyclohexanecarboxamide.
| Compound Name | N-[3-(3,4-difluorophenoxy)-2-hydroxypropyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 111102881 |
| Molecular Formula | C16H21F2NO3 |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | N-[3-(3,4-difluorophenoxy)-2-hydroxypropyl]cyclohexanecarboxamide |
| SMILES | O=C(NCC(O)COc1ccc(F)c(F)c1)C1CCCCC1 |
| InChI | InChI=1S/C16H21F2NO3/c17-14-7-6-13(8-15(14)18)22-10-12(20)9-19-16(21)11-4-2-1-3-5-11/h6-8,11-12,20H,1-5,9-10H2,(H,19,21) |
| InChIKey | YVACFAAOTONQSI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |