C17H22F2N2O3 — CID 111103979
1-(dicyclopropylmethyl)-3-[3-(3,4-difluorophenoxy)-2-hydroxypropyl]urea (PubChem CID 111103979) has the molecular formula C17H22F2N2O3 and a molecular weight of 340.37 g/mol. Its IUPAC name is 1-(dicyclopropylmethyl)-3-[3-(3,4-difluorophenoxy)-2-hydroxypropyl]urea.
| Compound Name | 1-(dicyclopropylmethyl)-3-[3-(3,4-difluorophenoxy)-2-hydroxypropyl]urea |
|---|---|
| PubChem CID | 111103979 |
| Molecular Formula | C17H22F2N2O3 |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 1-(dicyclopropylmethyl)-3-[3-(3,4-difluorophenoxy)-2-hydroxypropyl]urea |
| SMILES | O=C(NCC(O)COc1ccc(F)c(F)c1)NC(C1CC1)C1CC1 |
| InChI | InChI=1S/C17H22F2N2O3/c18-14-6-5-13(7-15(14)19)24-9-12(22)8-20-17(23)21-16(10-1-2-10)11-3-4-11/h5-7,10-12,16,22H,1-4,8-9H2,(H2,20,21,23) |
| InChIKey | BISZXIOMFABNCV-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |