C12H16F2N2O3 — CID 119319079
3-amino-N-[3-(3,4-difluorophenoxy)-2-hydroxypropyl]propanamide (PubChem CID 119319079) has the molecular formula C12H16F2N2O3 and a molecular weight of 274.27 g/mol. Its IUPAC name is 3-amino-N-[3-(3,4-difluorophenoxy)-2-hydroxypropyl]propanamide.
| Compound Name | 3-amino-N-[3-(3,4-difluorophenoxy)-2-hydroxypropyl]propanamide |
|---|---|
| PubChem CID | 119319079 |
| Molecular Formula | C12H16F2N2O3 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 3-amino-N-[3-(3,4-difluorophenoxy)-2-hydroxypropyl]propanamide |
| SMILES | NCCC(=O)NCC(O)COc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H16F2N2O3/c13-10-2-1-9(5-11(10)14)19-7-8(17)6-16-12(18)3-4-15/h1-2,5,8,17H,3-4,6-7,15H2,(H,16,18) |
| InChIKey | VQWUDRGFDPLMKZ-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |