C15H21F3N2O3 — CID 119751739
N-[2-hydroxy-3-[4-(trifluoromethyl)phenoxy]propyl]-4-(methylamino)butanamide (PubChem CID 119751739) has the molecular formula C15H21F3N2O3 and a molecular weight of 334.34 g/mol. Its IUPAC name is N-[2-hydroxy-3-[4-(trifluoromethyl)phenoxy]propyl]-4-(methylamino)butanamide.
| Compound Name | N-[2-hydroxy-3-[4-(trifluoromethyl)phenoxy]propyl]-4-(methylamino)butanamide |
|---|---|
| PubChem CID | 119751739 |
| Molecular Formula | C15H21F3N2O3 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | N-[2-hydroxy-3-[4-(trifluoromethyl)phenoxy]propyl]-4-(methylamino)butanamide |
| SMILES | CNCCCC(=O)NCC(O)COc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H21F3N2O3/c1-19-8-2-3-14(22)20-9-12(21)10-23-13-6-4-11(5-7-13)15(16,17)18/h4-7,12,19,21H,2-3,8-10H2,1H3,(H,20,22) |
| InChIKey | DFMZJLHBCMCPQV-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|