C16H23F3N2O3 — CID 119751777
(2S)-2-amino-N-[2-hydroxy-3-[4-(trifluoromethyl)phenoxy]propyl]-4-methylpentanamide (PubChem CID 119751777) has the molecular formula C16H23F3N2O3 and a molecular weight of 348.37 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-hydroxy-3-[4-(trifluoromethyl)phenoxy]propyl]-4-methylpentanamide.
| Compound Name | (2S)-2-amino-N-[2-hydroxy-3-[4-(trifluoromethyl)phenoxy]propyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 119751777 |
| Molecular Formula | C16H23F3N2O3 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | (2S)-2-amino-N-[2-hydroxy-3-[4-(trifluoromethyl)phenoxy]propyl]-4-methylpentanamide |
| SMILES | CC(C)C[C@H](N)C(=O)NCC(O)COc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H23F3N2O3/c1-10(2)7-14(20)15(23)21-8-12(22)9-24-13-5-3-11(4-6-13)16(17,18)19/h3-6,10,12,14,22H,7-9,20H2,1-2H3,(H,21,23)/t12?,14-/m0/s1 |
| InChIKey | YDXLFJTYINTJGO-PYMCNQPYSA-N |
| XLogP | 1.93 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |