C23H31FN2O2 — CID 72897099
1-[benzyl(methyl)amino]-3-[4-[(4-fluoropiperidin-1-yl)methyl]phenoxy]propan-2-ol (PubChem CID 72897099) has the molecular formula C23H31FN2O2 and a molecular weight of 386.51 g/mol. Its IUPAC name is 1-[benzyl(methyl)amino]-3-[4-[(4-fluoropiperidin-1-yl)methyl]phenoxy]propan-2-ol.
| Compound Name | 1-[benzyl(methyl)amino]-3-[4-[(4-fluoropiperidin-1-yl)methyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 72897099 |
| Molecular Formula | C23H31FN2O2 |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | 1-[benzyl(methyl)amino]-3-[4-[(4-fluoropiperidin-1-yl)methyl]phenoxy]propan-2-ol |
| SMILES | CN(Cc1ccccc1)CC(O)COc1ccc(CN2CCC(F)CC2)cc1 |
| InChI | InChI=1S/C23H31FN2O2/c1-25(15-19-5-3-2-4-6-19)17-22(27)18-28-23-9-7-20(8-10-23)16-26-13-11-21(24)12-14-26/h2-10,21-22,27H,11-18H2,1H3 |
| InChIKey | QDJDNQMMDQZITL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |