C23H24FN3O2 — CID 175691841
1-[(4-fluorophenyl)methyl-methylamino]-3-(4-phenyldiazenylphenoxy)propan-2-ol (PubChem CID 175691841) has the molecular formula C23H24FN3O2 and a molecular weight of 393.46 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl-methylamino]-3-(4-phenyldiazenylphenoxy)propan-2-ol.
| Compound Name | 1-[(4-fluorophenyl)methyl-methylamino]-3-(4-phenyldiazenylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 175691841 |
| Molecular Formula | C23H24FN3O2 |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl-methylamino]-3-(4-phenyldiazenylphenoxy)propan-2-ol |
| SMILES | CN(Cc1ccc(F)cc1)CC(O)COc1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C23H24FN3O2/c1-27(15-18-7-9-19(24)10-8-18)16-22(28)17-29-23-13-11-21(12-14-23)26-25-20-5-3-2-4-6-20/h2-14,22,28H,15-17H2,1H3/b26-25+ |
| InChIKey | DWFHCYJLQODLMY-OCEACIFDSA-N |
| XLogP | 5.11 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|