C19H29N3O3 — CID 5192686
2-[(1-benzylpiperidin-4-yl)carbamoylamino]-3-methylpentanoic acid (PubChem CID 5192686) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is 2-[(1-benzylpiperidin-4-yl)carbamoylamino]-3-methylpentanoic acid.
| Compound Name | 2-[(1-benzylpiperidin-4-yl)carbamoylamino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 5192686 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | 2-[(1-benzylpiperidin-4-yl)carbamoylamino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)NC1CCN(Cc2ccccc2)CC1)C(=O)O |
| InChI | InChI=1S/C19H29N3O3/c1-3-14(2)17(18(23)24)21-19(25)20-16-9-11-22(12-10-16)13-15-7-5-4-6-8-15/h4-8,14,16-17H,3,9-13H2,1-2H3,(H,23,24)(H2,20,21,25) |
| InChIKey | XGBNPZQBNQBQNN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |