C28H33N5O2 — CID 51726136
1-(1-benzylpiperidin-4-yl)-3-[(1S)-1-[4-(phenylcarbamoylamino)phenyl]ethyl]urea (PubChem CID 51726136) has the molecular formula C28H33N5O2 and a molecular weight of 471.61 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-3-[(1S)-1-[4-(phenylcarbamoylamino)phenyl]ethyl]urea.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-3-[(1S)-1-[4-(phenylcarbamoylamino)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 51726136 |
| Molecular Formula | C28H33N5O2 |
| Molecular Weight | 471.61 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-3-[(1S)-1-[4-(phenylcarbamoylamino)phenyl]ethyl]urea |
| SMILES | C[C@H](NC(=O)NC1CCN(Cc2ccccc2)CC1)c1ccc(NC(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C28H33N5O2/c1-21(23-12-14-25(15-13-23)31-28(35)30-24-10-6-3-7-11-24)29-27(34)32-26-16-18-33(19-17-26)20-22-8-4-2-5-9-22/h2-15,21,26H,16-20H2,1H3,(H2,29,32,34)(H2,30,31,35)/t21-/m0/s1 |
| InChIKey | RFPNQTNHECCPOL-NRFANRHFSA-N |
| XLogP | 5.36 |
| TPSA | 85.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.61 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |