C25H35N3O — CID 42695642
1-(1-benzylpiperidin-4-yl)-3-[2,6-di(propan-2-yl)phenyl]urea (PubChem CID 42695642) has the molecular formula C25H35N3O and a molecular weight of 393.58 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-3-[2,6-di(propan-2-yl)phenyl]urea.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-3-[2,6-di(propan-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 42695642 |
| Molecular Formula | C25H35N3O |
| Molecular Weight | 393.58 g/mol |
| Exact Mass | 393.28 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-3-[2,6-di(propan-2-yl)phenyl]urea |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H35N3O/c1-18(2)22-11-8-12-23(19(3)4)24(22)27-25(29)26-21-13-15-28(16-14-21)17-20-9-6-5-7-10-20/h5-12,18-19,21H,13-17H2,1-4H3,(H2,26,27,29) |
| InChIKey | CEMSRSNYEGPJLB-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.58 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |