C37H49N5O2 — CID 42753016
2-(4-benzylpiperazin-1-yl)-N-cyclohexyl-5-[[2,6-di(propan-2-yl)phenyl]carbamoylamino]benzamide (PubChem CID 42753016) has the molecular formula C37H49N5O2 and a molecular weight of 595.83 g/mol. Its IUPAC name is 2-(4-benzylpiperazin-1-yl)-N-cyclohexyl-5-[[2,6-di(propan-2-yl)phenyl]carbamoylamino]benzamide.
| Compound Name | 2-(4-benzylpiperazin-1-yl)-N-cyclohexyl-5-[[2,6-di(propan-2-yl)phenyl]carbamoylamino]benzamide |
|---|---|
| PubChem CID | 42753016 |
| Molecular Formula | C37H49N5O2 |
| Molecular Weight | 595.83 g/mol |
| Exact Mass | 595.39 |
| IUPAC Name | 2-(4-benzylpiperazin-1-yl)-N-cyclohexyl-5-[[2,6-di(propan-2-yl)phenyl]carbamoylamino]benzamide |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)Nc1ccc(N2CCN(Cc3ccccc3)CC2)c(C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C37H49N5O2/c1-26(2)31-16-11-17-32(27(3)4)35(31)40-37(44)39-30-18-19-34(33(24-30)36(43)38-29-14-9-6-10-15-29)42-22-20-41(21-23-42)25-28-12-7-5-8-13-28/h5,7-8,11-13,16-19,24,26-27,29H,6,9-10,14-15,20-23,25H2,1-4H3,(H,38,43)(H2,39,40,44) |
| InChIKey | LVUPIMPNPHQHGW-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.83 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|