C22H34N4O2 — CID 42752999
5-(tert-butylcarbamoylamino)-N-cyclohexyl-2-pyrrolidin-1-ylbenzamide (PubChem CID 42752999) has the molecular formula C22H34N4O2 and a molecular weight of 386.54 g/mol. Its IUPAC name is 5-(tert-butylcarbamoylamino)-N-cyclohexyl-2-pyrrolidin-1-ylbenzamide.
| Compound Name | 5-(tert-butylcarbamoylamino)-N-cyclohexyl-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 42752999 |
| Molecular Formula | C22H34N4O2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | 5-(tert-butylcarbamoylamino)-N-cyclohexyl-2-pyrrolidin-1-ylbenzamide |
| SMILES | CC(C)(C)NC(=O)Nc1ccc(N2CCCC2)c(C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C22H34N4O2/c1-22(2,3)25-21(28)24-17-11-12-19(26-13-7-8-14-26)18(15-17)20(27)23-16-9-5-4-6-10-16/h11-12,15-16H,4-10,13-14H2,1-3H3,(H,23,27)(H2,24,25,28) |
| InChIKey | JRMZNORULIKBRE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|