C24H28ClN3O2 — CID 42659848
5-[(3-chlorobenzoyl)amino]-N-cyclohexyl-2-pyrrolidin-1-ylbenzamide (PubChem CID 42659848) has the molecular formula C24H28ClN3O2 and a molecular weight of 425.96 g/mol. Its IUPAC name is 5-[(3-chlorobenzoyl)amino]-N-cyclohexyl-2-pyrrolidin-1-ylbenzamide.
| Compound Name | 5-[(3-chlorobenzoyl)amino]-N-cyclohexyl-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 42659848 |
| Molecular Formula | C24H28ClN3O2 |
| Molecular Weight | 425.96 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 5-[(3-chlorobenzoyl)amino]-N-cyclohexyl-2-pyrrolidin-1-ylbenzamide |
| SMILES | O=C(Nc1ccc(N2CCCC2)c(C(=O)NC2CCCCC2)c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C24H28ClN3O2/c25-18-8-6-7-17(15-18)23(29)27-20-11-12-22(28-13-4-5-14-28)21(16-20)24(30)26-19-9-2-1-3-10-19/h6-8,11-12,15-16,19H,1-5,9-10,13-14H2,(H,26,30)(H,27,29) |
| InChIKey | FRBYMFYEISJOCS-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.96 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|