C26H26ClN3O2 — CID 1065996
N-benzyl-5-[(3-chlorobenzoyl)amino]-2-piperidin-1-ylbenzamide (PubChem CID 1065996) has the molecular formula C26H26ClN3O2 and a molecular weight of 447.97 g/mol. Its IUPAC name is N-benzyl-5-[(3-chlorobenzoyl)amino]-2-piperidin-1-ylbenzamide.
| Compound Name | N-benzyl-5-[(3-chlorobenzoyl)amino]-2-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 1065996 |
| Molecular Formula | C26H26ClN3O2 |
| Molecular Weight | 447.97 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | N-benzyl-5-[(3-chlorobenzoyl)amino]-2-piperidin-1-ylbenzamide |
| SMILES | O=C(Nc1ccc(N2CCCCC2)c(C(=O)NCc2ccccc2)c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C26H26ClN3O2/c27-21-11-7-10-20(16-21)25(31)29-22-12-13-24(30-14-5-2-6-15-30)23(17-22)26(32)28-18-19-8-3-1-4-9-19/h1,3-4,7-13,16-17H,2,5-6,14-15,18H2,(H,28,32)(H,29,31) |
| InChIKey | AQPICQHBVQLKDX-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.97 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|