C26H26Cl2N4O2 — CID 42661807
N-benzyl-5-[(2,3-dichlorophenyl)carbamoylamino]-2-piperidin-1-ylbenzamide (PubChem CID 42661807) has the molecular formula C26H26Cl2N4O2 and a molecular weight of 497.43 g/mol. Its IUPAC name is N-benzyl-5-[(2,3-dichlorophenyl)carbamoylamino]-2-piperidin-1-ylbenzamide.
| Compound Name | N-benzyl-5-[(2,3-dichlorophenyl)carbamoylamino]-2-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 42661807 |
| Molecular Formula | C26H26Cl2N4O2 |
| Molecular Weight | 497.43 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | N-benzyl-5-[(2,3-dichlorophenyl)carbamoylamino]-2-piperidin-1-ylbenzamide |
| SMILES | O=C(Nc1ccc(N2CCCCC2)c(C(=O)NCc2ccccc2)c1)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C26H26Cl2N4O2/c27-21-10-7-11-22(24(21)28)31-26(34)30-19-12-13-23(32-14-5-2-6-15-32)20(16-19)25(33)29-17-18-8-3-1-4-9-18/h1,3-4,7-13,16H,2,5-6,14-15,17H2,(H,29,33)(H2,30,31,34) |
| InChIKey | YRFKYKRLPRQEQK-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.43 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|