C31H32N4O2 — CID 42661823
5-(naphthalen-1-ylcarbamoylamino)-N-(2-phenylethyl)-2-piperidin-1-ylbenzamide (PubChem CID 42661823) has the molecular formula C31H32N4O2 and a molecular weight of 492.62 g/mol. Its IUPAC name is 5-(naphthalen-1-ylcarbamoylamino)-N-(2-phenylethyl)-2-piperidin-1-ylbenzamide.
| Compound Name | 5-(naphthalen-1-ylcarbamoylamino)-N-(2-phenylethyl)-2-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 42661823 |
| Molecular Formula | C31H32N4O2 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | 5-(naphthalen-1-ylcarbamoylamino)-N-(2-phenylethyl)-2-piperidin-1-ylbenzamide |
| SMILES | O=C(Nc1ccc(N2CCCCC2)c(C(=O)NCCc2ccccc2)c1)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C31H32N4O2/c36-30(32-19-18-23-10-3-1-4-11-23)27-22-25(16-17-29(27)35-20-7-2-8-21-35)33-31(37)34-28-15-9-13-24-12-5-6-14-26(24)28/h1,3-6,9-17,22H,2,7-8,18-21H2,(H,32,36)(H2,33,34,37) |
| InChIKey | SOUOFNGNUGAJMO-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|