C27H27F3N4O2 — CID 1065454
N-(2-phenylethyl)-2-pyrrolidin-1-yl-5-[[3-(trifluoromethyl)phenyl]carbamoylamino]benzamide (PubChem CID 1065454) has the molecular formula C27H27F3N4O2 and a molecular weight of 496.53 g/mol. Its IUPAC name is N-(2-phenylethyl)-2-pyrrolidin-1-yl-5-[[3-(trifluoromethyl)phenyl]carbamoylamino]benzamide.
| Compound Name | N-(2-phenylethyl)-2-pyrrolidin-1-yl-5-[[3-(trifluoromethyl)phenyl]carbamoylamino]benzamide |
|---|---|
| PubChem CID | 1065454 |
| Molecular Formula | C27H27F3N4O2 |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | N-(2-phenylethyl)-2-pyrrolidin-1-yl-5-[[3-(trifluoromethyl)phenyl]carbamoylamino]benzamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)Nc1ccc(N2CCCC2)c(C(=O)NCCc2ccccc2)c1 |
| InChI | InChI=1S/C27H27F3N4O2/c28-27(29,30)20-9-6-10-21(17-20)32-26(36)33-22-11-12-24(34-15-4-5-16-34)23(18-22)25(35)31-14-13-19-7-2-1-3-8-19/h1-3,6-12,17-18H,4-5,13-16H2,(H,31,35)(H2,32,33,36) |
| InChIKey | UGJIALVDXNNEKL-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|