C26H35N3O2 — CID 1066073
5-(3,3-dimethylbutanoylamino)-N-(2-phenylethyl)-2-piperidin-1-ylbenzamide (PubChem CID 1066073) has the molecular formula C26H35N3O2 and a molecular weight of 421.59 g/mol. Its IUPAC name is 5-(3,3-dimethylbutanoylamino)-N-(2-phenylethyl)-2-piperidin-1-ylbenzamide.
| Compound Name | 5-(3,3-dimethylbutanoylamino)-N-(2-phenylethyl)-2-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 1066073 |
| Molecular Formula | C26H35N3O2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | 5-(3,3-dimethylbutanoylamino)-N-(2-phenylethyl)-2-piperidin-1-ylbenzamide |
| SMILES | CC(C)(C)CC(=O)Nc1ccc(N2CCCCC2)c(C(=O)NCCc2ccccc2)c1 |
| InChI | InChI=1S/C26H35N3O2/c1-26(2,3)19-24(30)28-21-12-13-23(29-16-8-5-9-17-29)22(18-21)25(31)27-15-14-20-10-6-4-7-11-20/h4,6-7,10-13,18H,5,8-9,14-17,19H2,1-3H3,(H,27,31)(H,28,30) |
| InChIKey | DJAQVTLBICBIFX-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|