C26H35N3O2 — CID 1066129
5-(3,3-dimethylbutanoylamino)-N-[(1S)-1-phenylethyl]-2-piperidin-1-ylbenzamide (PubChem CID 1066129) has the molecular formula C26H35N3O2 and a molecular weight of 421.59 g/mol. Its IUPAC name is 5-(3,3-dimethylbutanoylamino)-N-[(1S)-1-phenylethyl]-2-piperidin-1-ylbenzamide.
| Compound Name | 5-(3,3-dimethylbutanoylamino)-N-[(1S)-1-phenylethyl]-2-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 1066129 |
| Molecular Formula | C26H35N3O2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | 5-(3,3-dimethylbutanoylamino)-N-[(1S)-1-phenylethyl]-2-piperidin-1-ylbenzamide |
| SMILES | C[C@H](NC(=O)c1cc(NC(=O)CC(C)(C)C)ccc1N1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C26H35N3O2/c1-19(20-11-7-5-8-12-20)27-25(31)22-17-21(28-24(30)18-26(2,3)4)13-14-23(22)29-15-9-6-10-16-29/h5,7-8,11-14,17,19H,6,9-10,15-16,18H2,1-4H3,(H,27,31)(H,28,30)/t19-/m0/s1 |
| InChIKey | RVNAQJODXPYSSY-IBGZPJMESA-N |
| XLogP | 5.54 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|