C30H40N4O4 — CID 46185969
tert-butyl 4-[[3-(1-phenylethylcarbamoyl)-4-pyrrolidin-1-ylphenyl]carbamoyl]piperidine-1-carboxylate (PubChem CID 46185969) has the molecular formula C30H40N4O4 and a molecular weight of 520.67 g/mol. Its IUPAC name is tert-butyl 4-[[3-(1-phenylethylcarbamoyl)-4-pyrrolidin-1-ylphenyl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[3-(1-phenylethylcarbamoyl)-4-pyrrolidin-1-ylphenyl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 46185969 |
| Molecular Formula | C30H40N4O4 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.30 |
| IUPAC Name | tert-butyl 4-[[3-(1-phenylethylcarbamoyl)-4-pyrrolidin-1-ylphenyl]carbamoyl]piperidine-1-carboxylate |
| SMILES | CC(NC(=O)c1cc(NC(=O)C2CCN(C(=O)OC(C)(C)C)CC2)ccc1N1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C30H40N4O4/c1-21(22-10-6-5-7-11-22)31-28(36)25-20-24(12-13-26(25)33-16-8-9-17-33)32-27(35)23-14-18-34(19-15-23)29(37)38-30(2,3)4/h5-7,10-13,20-21,23H,8-9,14-19H2,1-4H3,(H,31,36)(H,32,35) |
| InChIKey | OBWXSOUTMNMYBL-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|