C23H28ClN3O2 — CID 1066160
5-[[(2S)-2-chloropropanoyl]amino]-N-[(1S)-1-phenylethyl]-2-piperidin-1-ylbenzamide (PubChem CID 1066160) has the molecular formula C23H28ClN3O2 and a molecular weight of 413.95 g/mol. Its IUPAC name is 5-[[(2S)-2-chloropropanoyl]amino]-N-[(1S)-1-phenylethyl]-2-piperidin-1-ylbenzamide.
| Compound Name | 5-[[(2S)-2-chloropropanoyl]amino]-N-[(1S)-1-phenylethyl]-2-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 1066160 |
| Molecular Formula | C23H28ClN3O2 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 5-[[(2S)-2-chloropropanoyl]amino]-N-[(1S)-1-phenylethyl]-2-piperidin-1-ylbenzamide |
| SMILES | C[C@H](Cl)C(=O)Nc1ccc(N2CCCCC2)c(C(=O)N[C@@H](C)c2ccccc2)c1 |
| InChI | InChI=1S/C23H28ClN3O2/c1-16(24)22(28)26-19-11-12-21(27-13-7-4-8-14-27)20(15-19)23(29)25-17(2)18-9-5-3-6-10-18/h3,5-6,9-12,15-17H,4,7-8,13-14H2,1-2H3,(H,25,29)(H,26,28)/t16-,17-/m0/s1 |
| InChIKey | FTMWUVAAPARLSD-IRXDYDNUSA-N |
| XLogP | 4.73 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|