C24H30ClN3O2 — CID 1063492
5-[[(2S)-2-chloropropanoyl]amino]-2-(4-methylpiperidin-1-yl)-N-[(1S)-1-phenylethyl]benzamide (PubChem CID 1063492) has the molecular formula C24H30ClN3O2 and a molecular weight of 427.98 g/mol. Its IUPAC name is 5-[[(2S)-2-chloropropanoyl]amino]-2-(4-methylpiperidin-1-yl)-N-[(1S)-1-phenylethyl]benzamide.
| Compound Name | 5-[[(2S)-2-chloropropanoyl]amino]-2-(4-methylpiperidin-1-yl)-N-[(1S)-1-phenylethyl]benzamide |
|---|---|
| PubChem CID | 1063492 |
| Molecular Formula | C24H30ClN3O2 |
| Molecular Weight | 427.98 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 5-[[(2S)-2-chloropropanoyl]amino]-2-(4-methylpiperidin-1-yl)-N-[(1S)-1-phenylethyl]benzamide |
| SMILES | CC1CCN(c2ccc(NC(=O)[C@H](C)Cl)cc2C(=O)N[C@@H](C)c2ccccc2)CC1 |
| InChI | InChI=1S/C24H30ClN3O2/c1-16-11-13-28(14-12-16)22-10-9-20(27-23(29)17(2)25)15-21(22)24(30)26-18(3)19-7-5-4-6-8-19/h4-10,15-18H,11-14H2,1-3H3,(H,26,30)(H,27,29)/t17-,18-/m0/s1 |
| InChIKey | VRQWLEXOBFVKMK-ROUUACIJSA-N |
| XLogP | 4.98 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.98 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|