C29H34N4O2 — CID 5166911
5-[(2-methylphenyl)carbamoylamino]-2-(4-methylpiperidin-1-yl)-N-(1-phenylethyl)benzamide (PubChem CID 5166911) has the molecular formula C29H34N4O2 and a molecular weight of 470.62 g/mol. Its IUPAC name is 5-[(2-methylphenyl)carbamoylamino]-2-(4-methylpiperidin-1-yl)-N-(1-phenylethyl)benzamide.
| Compound Name | 5-[(2-methylphenyl)carbamoylamino]-2-(4-methylpiperidin-1-yl)-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 5166911 |
| Molecular Formula | C29H34N4O2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | 5-[(2-methylphenyl)carbamoylamino]-2-(4-methylpiperidin-1-yl)-N-(1-phenylethyl)benzamide |
| SMILES | Cc1ccccc1NC(=O)Nc1ccc(N2CCC(C)CC2)c(C(=O)NC(C)c2ccccc2)c1 |
| InChI | InChI=1S/C29H34N4O2/c1-20-15-17-33(18-16-20)27-14-13-24(31-29(35)32-26-12-8-7-9-21(26)2)19-25(27)28(34)30-22(3)23-10-5-4-6-11-23/h4-14,19-20,22H,15-18H2,1-3H3,(H,30,34)(H2,31,32,35) |
| InChIKey | BKIQRFGFLVHQTN-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|