C26H34N4O3 — CID 42662041
5-[(2-methylphenyl)carbamoylamino]-2-(4-methylpiperidin-1-yl)-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 42662041) has the molecular formula C26H34N4O3 and a molecular weight of 450.58 g/mol. Its IUPAC name is 5-[(2-methylphenyl)carbamoylamino]-2-(4-methylpiperidin-1-yl)-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 5-[(2-methylphenyl)carbamoylamino]-2-(4-methylpiperidin-1-yl)-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 42662041 |
| Molecular Formula | C26H34N4O3 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | 5-[(2-methylphenyl)carbamoylamino]-2-(4-methylpiperidin-1-yl)-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | Cc1ccccc1NC(=O)Nc1ccc(N2CCC(C)CC2)c(C(=O)NCC2CCCO2)c1 |
| InChI | InChI=1S/C26H34N4O3/c1-18-11-13-30(14-12-18)24-10-9-20(28-26(32)29-23-8-4-3-6-19(23)2)16-22(24)25(31)27-17-21-7-5-15-33-21/h3-4,6,8-10,16,18,21H,5,7,11-15,17H2,1-2H3,(H,27,31)(H2,28,29,32) |
| InChIKey | LNAILYZINUOENC-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|