C26H33N3O3 — CID 3283955
5-[(2-methylbenzoyl)amino]-2-(4-methylpiperidin-1-yl)-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 3283955) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is 5-[(2-methylbenzoyl)amino]-2-(4-methylpiperidin-1-yl)-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 5-[(2-methylbenzoyl)amino]-2-(4-methylpiperidin-1-yl)-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 3283955 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | 5-[(2-methylbenzoyl)amino]-2-(4-methylpiperidin-1-yl)-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | Cc1ccccc1C(=O)Nc1ccc(N2CCC(C)CC2)c(C(=O)NCC2CCCO2)c1 |
| InChI | InChI=1S/C26H33N3O3/c1-18-11-13-29(14-12-18)24-10-9-20(28-26(31)22-8-4-3-6-19(22)2)16-23(24)25(30)27-17-21-7-5-15-32-21/h3-4,6,8-10,16,18,21H,5,7,11-15,17H2,1-2H3,(H,27,30)(H,28,31) |
| InChIKey | PVRBEIABYMYHHQ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|