C26H39N3O3 — CID 3889047
5-(3-cyclopentylpropanoylamino)-2-(4-methylpiperidin-1-yl)-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 3889047) has the molecular formula C26H39N3O3 and a molecular weight of 441.62 g/mol. Its IUPAC name is 5-(3-cyclopentylpropanoylamino)-2-(4-methylpiperidin-1-yl)-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 5-(3-cyclopentylpropanoylamino)-2-(4-methylpiperidin-1-yl)-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 3889047 |
| Molecular Formula | C26H39N3O3 |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.30 |
| IUPAC Name | 5-(3-cyclopentylpropanoylamino)-2-(4-methylpiperidin-1-yl)-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | CC1CCN(c2ccc(NC(=O)CCC3CCCC3)cc2C(=O)NCC2CCCO2)CC1 |
| InChI | InChI=1S/C26H39N3O3/c1-19-12-14-29(15-13-19)24-10-9-21(28-25(30)11-8-20-5-2-3-6-20)17-23(24)26(31)27-18-22-7-4-16-32-22/h9-10,17,19-20,22H,2-8,11-16,18H2,1H3,(H,27,31)(H,28,30) |
| InChIKey | LXMMJCQJQOVDSW-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|