C27H36N4O4 — CID 93099870
5-[(4-ethoxyphenyl)carbamoylamino]-2-(4-methylpiperidin-1-yl)-N-[[(2S)-oxolan-2-yl]methyl]benzamide (PubChem CID 93099870) has the molecular formula C27H36N4O4 and a molecular weight of 480.61 g/mol. Its IUPAC name is 5-[(4-ethoxyphenyl)carbamoylamino]-2-(4-methylpiperidin-1-yl)-N-[[(2S)-oxolan-2-yl]methyl]benzamide.
| Compound Name | 5-[(4-ethoxyphenyl)carbamoylamino]-2-(4-methylpiperidin-1-yl)-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 93099870 |
| Molecular Formula | C27H36N4O4 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | 5-[(4-ethoxyphenyl)carbamoylamino]-2-(4-methylpiperidin-1-yl)-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
| SMILES | CCOc1ccc(NC(=O)Nc2ccc(N3CCC(C)CC3)c(C(=O)NC[C@@H]3CCCO3)c2)cc1 |
| InChI | InChI=1S/C27H36N4O4/c1-3-34-22-9-6-20(7-10-22)29-27(33)30-21-8-11-25(31-14-12-19(2)13-15-31)24(17-21)26(32)28-18-23-5-4-16-35-23/h6-11,17,19,23H,3-5,12-16,18H2,1-2H3,(H,28,32)(H2,29,30,33)/t23-/m0/s1 |
| InChIKey | HCHBYAONZMAUTL-QHCPKHFHSA-N |
| XLogP | 4.87 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|