C23H27BrN4O3 — CID 5199981
5-[(4-bromophenyl)carbamoylamino]-N-(oxolan-2-ylmethyl)-2-pyrrolidin-1-ylbenzamide (PubChem CID 5199981) has the molecular formula C23H27BrN4O3 and a molecular weight of 487.40 g/mol. Its IUPAC name is 5-[(4-bromophenyl)carbamoylamino]-N-(oxolan-2-ylmethyl)-2-pyrrolidin-1-ylbenzamide.
| Compound Name | 5-[(4-bromophenyl)carbamoylamino]-N-(oxolan-2-ylmethyl)-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 5199981 |
| Molecular Formula | C23H27BrN4O3 |
| Molecular Weight | 487.40 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | 5-[(4-bromophenyl)carbamoylamino]-N-(oxolan-2-ylmethyl)-2-pyrrolidin-1-ylbenzamide |
| SMILES | O=C(Nc1ccc(Br)cc1)Nc1ccc(N2CCCC2)c(C(=O)NCC2CCCO2)c1 |
| InChI | InChI=1S/C23H27BrN4O3/c24-16-5-7-17(8-6-16)26-23(30)27-18-9-10-21(28-11-1-2-12-28)20(14-18)22(29)25-15-19-4-3-13-31-19/h5-10,14,19H,1-4,11-13,15H2,(H,25,29)(H2,26,27,30) |
| InChIKey | BABFYTWRQDMHLI-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|