C24H28BrN3O3 — CID 5228862
5-[(3-bromobenzoyl)amino]-N-(oxolan-2-ylmethyl)-2-piperidin-1-ylbenzamide (PubChem CID 5228862) has the molecular formula C24H28BrN3O3 and a molecular weight of 486.41 g/mol. Its IUPAC name is 5-[(3-bromobenzoyl)amino]-N-(oxolan-2-ylmethyl)-2-piperidin-1-ylbenzamide.
| Compound Name | 5-[(3-bromobenzoyl)amino]-N-(oxolan-2-ylmethyl)-2-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 5228862 |
| Molecular Formula | C24H28BrN3O3 |
| Molecular Weight | 486.41 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 5-[(3-bromobenzoyl)amino]-N-(oxolan-2-ylmethyl)-2-piperidin-1-ylbenzamide |
| SMILES | O=C(Nc1ccc(N2CCCCC2)c(C(=O)NCC2CCCO2)c1)c1cccc(Br)c1 |
| InChI | InChI=1S/C24H28BrN3O3/c25-18-7-4-6-17(14-18)23(29)27-19-9-10-22(28-11-2-1-3-12-28)21(15-19)24(30)26-16-20-8-5-13-31-20/h4,6-7,9-10,14-15,20H,1-3,5,8,11-13,16H2,(H,26,30)(H,27,29) |
| InChIKey | USKJPIFKGPYMAI-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.41 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|