C27H35N3O3 — CID 1055116
N-[[(2S)-oxolan-2-yl]methyl]-5-[[(2R)-2-phenylbutanoyl]amino]-2-piperidin-1-ylbenzamide (PubChem CID 1055116) has the molecular formula C27H35N3O3 and a molecular weight of 449.60 g/mol. Its IUPAC name is N-[[(2S)-oxolan-2-yl]methyl]-5-[[(2R)-2-phenylbutanoyl]amino]-2-piperidin-1-ylbenzamide.
| Compound Name | N-[[(2S)-oxolan-2-yl]methyl]-5-[[(2R)-2-phenylbutanoyl]amino]-2-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 1055116 |
| Molecular Formula | C27H35N3O3 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | N-[[(2S)-oxolan-2-yl]methyl]-5-[[(2R)-2-phenylbutanoyl]amino]-2-piperidin-1-ylbenzamide |
| SMILES | CC[C@@H](C(=O)Nc1ccc(N2CCCCC2)c(C(=O)NC[C@@H]2CCCO2)c1)c1ccccc1 |
| InChI | InChI=1S/C27H35N3O3/c1-2-23(20-10-5-3-6-11-20)27(32)29-21-13-14-25(30-15-7-4-8-16-30)24(18-21)26(31)28-19-22-12-9-17-33-22/h3,5-6,10-11,13-14,18,22-23H,2,4,7-9,12,15-17,19H2,1H3,(H,28,31)(H,29,32)/t22-,23+/m0/s1 |
| InChIKey | DYFCFNKAOGQAHN-XZOQPEGZSA-N |
| XLogP | 4.72 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|