C27H29N3O3 — CID 3994766
N-[3-(oxolan-2-ylmethylcarbamoyl)-4-pyrrolidin-1-ylphenyl]naphthalene-1-carboxamide (PubChem CID 3994766) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is N-[3-(oxolan-2-ylmethylcarbamoyl)-4-pyrrolidin-1-ylphenyl]naphthalene-1-carboxamide.
| Compound Name | N-[3-(oxolan-2-ylmethylcarbamoyl)-4-pyrrolidin-1-ylphenyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 3994766 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | N-[3-(oxolan-2-ylmethylcarbamoyl)-4-pyrrolidin-1-ylphenyl]naphthalene-1-carboxamide |
| SMILES | O=C(NCC1CCCO1)c1cc(NC(=O)c2cccc3ccccc23)ccc1N1CCCC1 |
| InChI | InChI=1S/C27H29N3O3/c31-26(28-18-21-9-6-16-33-21)24-17-20(12-13-25(24)30-14-3-4-15-30)29-27(32)23-11-5-8-19-7-1-2-10-22(19)23/h1-2,5,7-8,10-13,17,21H,3-4,6,9,14-16,18H2,(H,28,31)(H,29,32) |
| InChIKey | GEZGGHLRYQSREB-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|