C23H25Cl2N3O3 — CID 5109469
5-[(2,4-dichlorobenzoyl)amino]-N-(oxolan-2-ylmethyl)-2-pyrrolidin-1-ylbenzamide (PubChem CID 5109469) has the molecular formula C23H25Cl2N3O3 and a molecular weight of 462.38 g/mol. Its IUPAC name is 5-[(2,4-dichlorobenzoyl)amino]-N-(oxolan-2-ylmethyl)-2-pyrrolidin-1-ylbenzamide.
| Compound Name | 5-[(2,4-dichlorobenzoyl)amino]-N-(oxolan-2-ylmethyl)-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 5109469 |
| Molecular Formula | C23H25Cl2N3O3 |
| Molecular Weight | 462.38 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | 5-[(2,4-dichlorobenzoyl)amino]-N-(oxolan-2-ylmethyl)-2-pyrrolidin-1-ylbenzamide |
| SMILES | O=C(Nc1ccc(N2CCCC2)c(C(=O)NCC2CCCO2)c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H25Cl2N3O3/c24-15-5-7-18(20(25)12-15)23(30)27-16-6-8-21(28-9-1-2-10-28)19(13-16)22(29)26-14-17-4-3-11-31-17/h5-8,12-13,17H,1-4,9-11,14H2,(H,26,29)(H,27,30) |
| InChIKey | ROEULJSCCVBPCN-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.38 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|