C31H33Cl2N3O3 — CID 98420900
2-(4-benzylpiperidin-1-yl)-5-[(2,4-dichlorobenzoyl)amino]-N-[[(2R)-oxolan-2-yl]methyl]benzamide (PubChem CID 98420900) has the molecular formula C31H33Cl2N3O3 and a molecular weight of 566.53 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-5-[(2,4-dichlorobenzoyl)amino]-N-[[(2R)-oxolan-2-yl]methyl]benzamide.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-5-[(2,4-dichlorobenzoyl)amino]-N-[[(2R)-oxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 98420900 |
| Molecular Formula | C31H33Cl2N3O3 |
| Molecular Weight | 566.53 g/mol |
| Exact Mass | 565.19 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-5-[(2,4-dichlorobenzoyl)amino]-N-[[(2R)-oxolan-2-yl]methyl]benzamide |
| SMILES | O=C(Nc1ccc(N2CCC(Cc3ccccc3)CC2)c(C(=O)NC[C@H]2CCCO2)c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C31H33Cl2N3O3/c32-23-8-10-26(28(33)18-23)31(38)35-24-9-11-29(27(19-24)30(37)34-20-25-7-4-16-39-25)36-14-12-22(13-15-36)17-21-5-2-1-3-6-21/h1-3,5-6,8-11,18-19,22,25H,4,7,12-17,20H2,(H,34,37)(H,35,38)/t25-/m1/s1 |
| InChIKey | VDGWHCRKHWMSFN-RUZDIDTESA-N |
| XLogP | 6.61 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.53 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|