C31H34F2N4O3 — CID 98324653
2-(4-benzylpiperidin-1-yl)-5-[(3,4-difluorophenyl)carbamoylamino]-N-[[(2S)-oxolan-2-yl]methyl]benzamide (PubChem CID 98324653) has the molecular formula C31H34F2N4O3 and a molecular weight of 548.63 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-5-[(3,4-difluorophenyl)carbamoylamino]-N-[[(2S)-oxolan-2-yl]methyl]benzamide.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-5-[(3,4-difluorophenyl)carbamoylamino]-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 98324653 |
| Molecular Formula | C31H34F2N4O3 |
| Molecular Weight | 548.63 g/mol |
| Exact Mass | 548.26 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-5-[(3,4-difluorophenyl)carbamoylamino]-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1)Nc1ccc(N2CCC(Cc3ccccc3)CC2)c(C(=O)NC[C@@H]2CCCO2)c1 |
| InChI | InChI=1S/C31H34F2N4O3/c32-27-10-8-24(19-28(27)33)36-31(39)35-23-9-11-29(26(18-23)30(38)34-20-25-7-4-16-40-25)37-14-12-22(13-15-37)17-21-5-2-1-3-6-21/h1-3,5-6,8-11,18-19,22,25H,4,7,12-17,20H2,(H,34,38)(H2,35,36,39)/t25-/m0/s1 |
| InChIKey | DIIKBFWIONNFJH-VWLOTQADSA-N |
| XLogP | 5.98 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.63 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|