C32H34F3N3O3 — CID 5199983
2-(4-benzylpiperidin-1-yl)-N-(oxolan-2-ylmethyl)-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide (PubChem CID 5199983) has the molecular formula C32H34F3N3O3 and a molecular weight of 565.64 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-N-(oxolan-2-ylmethyl)-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-N-(oxolan-2-ylmethyl)-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 5199983 |
| Molecular Formula | C32H34F3N3O3 |
| Molecular Weight | 565.64 g/mol |
| Exact Mass | 565.26 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-N-(oxolan-2-ylmethyl)-5-[[3-(trifluoromethyl)benzoyl]amino]benzamide |
| SMILES | O=C(Nc1ccc(N2CCC(Cc3ccccc3)CC2)c(C(=O)NCC2CCCO2)c1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C32H34F3N3O3/c33-32(34,35)25-9-4-8-24(19-25)30(39)37-26-11-12-29(28(20-26)31(40)36-21-27-10-5-17-41-27)38-15-13-23(14-16-38)18-22-6-2-1-3-7-22/h1-4,6-9,11-12,19-20,23,27H,5,10,13-18,21H2,(H,36,40)(H,37,39) |
| InChIKey | YUKCWSVJGBRDIA-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.64 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|