C35H38N4O3 — CID 98324626
2-(4-benzylpiperidin-1-yl)-5-(naphthalen-1-ylcarbamoylamino)-N-[[(2R)-oxolan-2-yl]methyl]benzamide (PubChem CID 98324626) has the molecular formula C35H38N4O3 and a molecular weight of 562.71 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-5-(naphthalen-1-ylcarbamoylamino)-N-[[(2R)-oxolan-2-yl]methyl]benzamide.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-5-(naphthalen-1-ylcarbamoylamino)-N-[[(2R)-oxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 98324626 |
| Molecular Formula | C35H38N4O3 |
| Molecular Weight | 562.71 g/mol |
| Exact Mass | 562.29 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-5-(naphthalen-1-ylcarbamoylamino)-N-[[(2R)-oxolan-2-yl]methyl]benzamide |
| SMILES | O=C(Nc1ccc(N2CCC(Cc3ccccc3)CC2)c(C(=O)NC[C@H]2CCCO2)c1)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C35H38N4O3/c40-34(36-24-29-12-7-21-42-29)31-23-28(37-35(41)38-32-14-6-11-27-10-4-5-13-30(27)32)15-16-33(31)39-19-17-26(18-20-39)22-25-8-2-1-3-9-25/h1-6,8-11,13-16,23,26,29H,7,12,17-22,24H2,(H,36,40)(H2,37,38,41)/t29-/m1/s1 |
| InChIKey | XFZZTQNEWKILCL-GDLZYMKVSA-N |
| XLogP | 6.85 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.71 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|