C31H35FN4O3 — CID 3504793
2-(4-benzylpiperidin-1-yl)-5-[(2-fluorophenyl)carbamoylamino]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 3504793) has the molecular formula C31H35FN4O3 and a molecular weight of 530.64 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-5-[(2-fluorophenyl)carbamoylamino]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-5-[(2-fluorophenyl)carbamoylamino]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 3504793 |
| Molecular Formula | C31H35FN4O3 |
| Molecular Weight | 530.64 g/mol |
| Exact Mass | 530.27 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-5-[(2-fluorophenyl)carbamoylamino]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | O=C(Nc1ccc(N2CCC(Cc3ccccc3)CC2)c(C(=O)NCC2CCCO2)c1)Nc1ccccc1F |
| InChI | InChI=1S/C31H35FN4O3/c32-27-10-4-5-11-28(27)35-31(38)34-24-12-13-29(26(20-24)30(37)33-21-25-9-6-18-39-25)36-16-14-23(15-17-36)19-22-7-2-1-3-8-22/h1-5,7-8,10-13,20,23,25H,6,9,14-19,21H2,(H,33,37)(H2,34,35,38) |
| InChIKey | IPVWKGCENMFFDW-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.64 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|