C33H32F2N4O2 — CID 3978698
2-(4-benzylpiperidin-1-yl)-5-[(2-fluorophenyl)carbamoylamino]-N-[(4-fluorophenyl)methyl]benzamide (PubChem CID 3978698) has the molecular formula C33H32F2N4O2 and a molecular weight of 554.64 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-5-[(2-fluorophenyl)carbamoylamino]-N-[(4-fluorophenyl)methyl]benzamide.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-5-[(2-fluorophenyl)carbamoylamino]-N-[(4-fluorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 3978698 |
| Molecular Formula | C33H32F2N4O2 |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-5-[(2-fluorophenyl)carbamoylamino]-N-[(4-fluorophenyl)methyl]benzamide |
| SMILES | O=C(Nc1ccc(N2CCC(Cc3ccccc3)CC2)c(C(=O)NCc2ccc(F)cc2)c1)Nc1ccccc1F |
| InChI | InChI=1S/C33H32F2N4O2/c34-26-12-10-25(11-13-26)22-36-32(40)28-21-27(37-33(41)38-30-9-5-4-8-29(30)35)14-15-31(28)39-18-16-24(17-19-39)20-23-6-2-1-3-7-23/h1-15,21,24H,16-20,22H2,(H,36,40)(H2,37,38,41) |
| InChIKey | KZHHDJBDEWEEAZ-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|