C36H40N4O2 — CID 42659015
2-(4-benzylpiperidin-1-yl)-5-[(2,3-dimethylphenyl)carbamoylamino]-N-(2-phenylethyl)benzamide (PubChem CID 42659015) has the molecular formula C36H40N4O2 and a molecular weight of 560.74 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-5-[(2,3-dimethylphenyl)carbamoylamino]-N-(2-phenylethyl)benzamide.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-5-[(2,3-dimethylphenyl)carbamoylamino]-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 42659015 |
| Molecular Formula | C36H40N4O2 |
| Molecular Weight | 560.74 g/mol |
| Exact Mass | 560.32 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-5-[(2,3-dimethylphenyl)carbamoylamino]-N-(2-phenylethyl)benzamide |
| SMILES | Cc1cccc(NC(=O)Nc2ccc(N3CCC(Cc4ccccc4)CC3)c(C(=O)NCCc3ccccc3)c2)c1C |
| InChI | InChI=1S/C36H40N4O2/c1-26-10-9-15-33(27(26)2)39-36(42)38-31-16-17-34(32(25-31)35(41)37-21-18-28-11-5-3-6-12-28)40-22-19-30(20-23-40)24-29-13-7-4-8-14-29/h3-17,25,30H,18-24H2,1-2H3,(H,37,41)(H2,38,39,42) |
| InChIKey | LLBVITHTKJAVMT-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.74 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|