C34H33Cl2N3O2 — CID 3879115
N-[4-(4-benzylpiperidin-1-yl)-3-(2-phenylethylcarbamoyl)phenyl]-3,4-dichlorobenzamide (PubChem CID 3879115) has the molecular formula C34H33Cl2N3O2 and a molecular weight of 586.56 g/mol. Its IUPAC name is N-[4-(4-benzylpiperidin-1-yl)-3-(2-phenylethylcarbamoyl)phenyl]-3,4-dichlorobenzamide.
| Compound Name | N-[4-(4-benzylpiperidin-1-yl)-3-(2-phenylethylcarbamoyl)phenyl]-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 3879115 |
| Molecular Formula | C34H33Cl2N3O2 |
| Molecular Weight | 586.56 g/mol |
| Exact Mass | 585.19 |
| IUPAC Name | N-[4-(4-benzylpiperidin-1-yl)-3-(2-phenylethylcarbamoyl)phenyl]-3,4-dichlorobenzamide |
| SMILES | O=C(Nc1ccc(N2CCC(Cc3ccccc3)CC2)c(C(=O)NCCc2ccccc2)c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C34H33Cl2N3O2/c35-30-13-11-27(22-31(30)36)33(40)38-28-12-14-32(29(23-28)34(41)37-18-15-24-7-3-1-4-8-24)39-19-16-26(17-20-39)21-25-9-5-2-6-10-25/h1-14,22-23,26H,15-21H2,(H,37,41)(H,38,40) |
| InChIKey | CENPTDZYBDCYNG-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.56 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|