C33H39ClN4O3 — CID 5219081
2-(4-benzylpiperidin-1-yl)-5-[(2-chlorobenzoyl)amino]-N-(3-morpholin-4-ylpropyl)benzamide (PubChem CID 5219081) has the molecular formula C33H39ClN4O3 and a molecular weight of 575.15 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-5-[(2-chlorobenzoyl)amino]-N-(3-morpholin-4-ylpropyl)benzamide.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-5-[(2-chlorobenzoyl)amino]-N-(3-morpholin-4-ylpropyl)benzamide |
|---|---|
| PubChem CID | 5219081 |
| Molecular Formula | C33H39ClN4O3 |
| Molecular Weight | 575.15 g/mol |
| Exact Mass | 574.27 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-5-[(2-chlorobenzoyl)amino]-N-(3-morpholin-4-ylpropyl)benzamide |
| SMILES | O=C(Nc1ccc(N2CCC(Cc3ccccc3)CC2)c(C(=O)NCCCN2CCOCC2)c1)c1ccccc1Cl |
| InChI | InChI=1S/C33H39ClN4O3/c34-30-10-5-4-9-28(30)33(40)36-27-11-12-31(38-17-13-26(14-18-38)23-25-7-2-1-3-8-25)29(24-27)32(39)35-15-6-16-37-19-21-41-22-20-37/h1-5,7-12,24,26H,6,13-23H2,(H,35,39)(H,36,40) |
| InChIKey | WLCXUCXNDYXCFI-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.15 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|