C36H54N4O3 — CID 42659443
2-(4-benzylpiperidin-1-yl)-5-(decanoylamino)-N-(3-morpholin-4-ylpropyl)benzamide (PubChem CID 42659443) has the molecular formula C36H54N4O3 and a molecular weight of 590.85 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-5-(decanoylamino)-N-(3-morpholin-4-ylpropyl)benzamide.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-5-(decanoylamino)-N-(3-morpholin-4-ylpropyl)benzamide |
|---|---|
| PubChem CID | 42659443 |
| Molecular Formula | C36H54N4O3 |
| Molecular Weight | 590.85 g/mol |
| Exact Mass | 590.42 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-5-(decanoylamino)-N-(3-morpholin-4-ylpropyl)benzamide |
| SMILES | CCCCCCCCCC(=O)Nc1ccc(N2CCC(Cc3ccccc3)CC2)c(C(=O)NCCCN2CCOCC2)c1 |
| InChI | InChI=1S/C36H54N4O3/c1-2-3-4-5-6-7-11-15-35(41)38-32-16-17-34(40-22-18-31(19-23-40)28-30-13-9-8-10-14-30)33(29-32)36(42)37-20-12-21-39-24-26-43-27-25-39/h8-10,13-14,16-17,29,31H,2-7,11-12,15,18-28H2,1H3,(H,37,42)(H,38,41) |
| InChIKey | HDTSVXSFTTTZPV-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.85 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|