C32H45N3O2 — CID 4012959
2-(4-benzylpiperidin-1-yl)-N-cyclopropyl-5-(decanoylamino)benzamide (PubChem CID 4012959) has the molecular formula C32H45N3O2 and a molecular weight of 503.73 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-N-cyclopropyl-5-(decanoylamino)benzamide.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-N-cyclopropyl-5-(decanoylamino)benzamide |
|---|---|
| PubChem CID | 4012959 |
| Molecular Formula | C32H45N3O2 |
| Molecular Weight | 503.73 g/mol |
| Exact Mass | 503.35 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-N-cyclopropyl-5-(decanoylamino)benzamide |
| SMILES | CCCCCCCCCC(=O)Nc1ccc(N2CCC(Cc3ccccc3)CC2)c(C(=O)NC2CC2)c1 |
| InChI | InChI=1S/C32H45N3O2/c1-2-3-4-5-6-7-11-14-31(36)33-28-17-18-30(29(24-28)32(37)34-27-15-16-27)35-21-19-26(20-22-35)23-25-12-9-8-10-13-25/h8-10,12-13,17-18,24,26-27H,2-7,11,14-16,19-23H2,1H3,(H,33,36)(H,34,37) |
| InChIKey | XEGVVCUWQHFNOV-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.73 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|