C29H31N5O4 — CID 42757368
2-(4-benzylpiperidin-1-yl)-N-cyclopropyl-5-[(4-nitrophenyl)carbamoylamino]benzamide (PubChem CID 42757368) has the molecular formula C29H31N5O4 and a molecular weight of 513.60 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-N-cyclopropyl-5-[(4-nitrophenyl)carbamoylamino]benzamide.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-N-cyclopropyl-5-[(4-nitrophenyl)carbamoylamino]benzamide |
|---|---|
| PubChem CID | 42757368 |
| Molecular Formula | C29H31N5O4 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-N-cyclopropyl-5-[(4-nitrophenyl)carbamoylamino]benzamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1)Nc1ccc(N2CCC(Cc3ccccc3)CC2)c(C(=O)NC2CC2)c1 |
| InChI | InChI=1S/C29H31N5O4/c35-28(30-22-6-7-22)26-19-24(32-29(36)31-23-8-11-25(12-9-23)34(37)38)10-13-27(26)33-16-14-21(15-17-33)18-20-4-2-1-3-5-20/h1-5,8-13,19,21-22H,6-7,14-18H2,(H,30,35)(H2,31,32,36) |
| InChIKey | RBKIUWXSJWEDHG-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|