C31H34ClN5O4 — CID 4238779
2-(4-benzylpiperazin-1-yl)-5-[(2-chloro-4-nitrobenzoyl)amino]-N-cyclohexylbenzamide (PubChem CID 4238779) has the molecular formula C31H34ClN5O4 and a molecular weight of 576.10 g/mol. Its IUPAC name is 2-(4-benzylpiperazin-1-yl)-5-[(2-chloro-4-nitrobenzoyl)amino]-N-cyclohexylbenzamide.
| Compound Name | 2-(4-benzylpiperazin-1-yl)-5-[(2-chloro-4-nitrobenzoyl)amino]-N-cyclohexylbenzamide |
|---|---|
| PubChem CID | 4238779 |
| Molecular Formula | C31H34ClN5O4 |
| Molecular Weight | 576.10 g/mol |
| Exact Mass | 575.23 |
| IUPAC Name | 2-(4-benzylpiperazin-1-yl)-5-[(2-chloro-4-nitrobenzoyl)amino]-N-cyclohexylbenzamide |
| SMILES | O=C(Nc1ccc(N2CCN(Cc3ccccc3)CC2)c(C(=O)NC2CCCCC2)c1)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C31H34ClN5O4/c32-28-20-25(37(40)41)12-13-26(28)30(38)34-24-11-14-29(27(19-24)31(39)33-23-9-5-2-6-10-23)36-17-15-35(16-18-36)21-22-7-3-1-4-8-22/h1,3-4,7-8,11-14,19-20,23H,2,5-6,9-10,15-18,21H2,(H,33,39)(H,34,38) |
| InChIKey | OPZAWGQPRFDGFJ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.10 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|