C32H46N4O2 — CID 3953572
2-(4-benzylpiperazin-1-yl)-N-cyclohexyl-5-(2-ethylhexanoylamino)benzamide (PubChem CID 3953572) has the molecular formula C32H46N4O2 and a molecular weight of 518.75 g/mol. Its IUPAC name is 2-(4-benzylpiperazin-1-yl)-N-cyclohexyl-5-(2-ethylhexanoylamino)benzamide.
| Compound Name | 2-(4-benzylpiperazin-1-yl)-N-cyclohexyl-5-(2-ethylhexanoylamino)benzamide |
|---|---|
| PubChem CID | 3953572 |
| Molecular Formula | C32H46N4O2 |
| Molecular Weight | 518.75 g/mol |
| Exact Mass | 518.36 |
| IUPAC Name | 2-(4-benzylpiperazin-1-yl)-N-cyclohexyl-5-(2-ethylhexanoylamino)benzamide |
| SMILES | CCCCC(CC)C(=O)Nc1ccc(N2CCN(Cc3ccccc3)CC2)c(C(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C32H46N4O2/c1-3-5-14-26(4-2)31(37)34-28-17-18-30(29(23-28)32(38)33-27-15-10-7-11-16-27)36-21-19-35(20-22-36)24-25-12-8-6-9-13-25/h6,8-9,12-13,17-18,23,26-27H,3-5,7,10-11,14-16,19-22,24H2,1-2H3,(H,33,38)(H,34,37) |
| InChIKey | MSENCRXJIVVXRO-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.75 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|