C29H41N3O2 — CID 4015486
5-(2-ethylhexanoylamino)-2-(4-methylpiperidin-1-yl)-N-(2-phenylethyl)benzamide (PubChem CID 4015486) has the molecular formula C29H41N3O2 and a molecular weight of 463.67 g/mol. Its IUPAC name is 5-(2-ethylhexanoylamino)-2-(4-methylpiperidin-1-yl)-N-(2-phenylethyl)benzamide.
| Compound Name | 5-(2-ethylhexanoylamino)-2-(4-methylpiperidin-1-yl)-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 4015486 |
| Molecular Formula | C29H41N3O2 |
| Molecular Weight | 463.67 g/mol |
| Exact Mass | 463.32 |
| IUPAC Name | 5-(2-ethylhexanoylamino)-2-(4-methylpiperidin-1-yl)-N-(2-phenylethyl)benzamide |
| SMILES | CCCCC(CC)C(=O)Nc1ccc(N2CCC(C)CC2)c(C(=O)NCCc2ccccc2)c1 |
| InChI | InChI=1S/C29H41N3O2/c1-4-6-12-24(5-2)28(33)31-25-13-14-27(32-19-16-22(3)17-20-32)26(21-25)29(34)30-18-15-23-10-8-7-9-11-23/h7-11,13-14,21-22,24H,4-6,12,15-20H2,1-3H3,(H,30,34)(H,31,33) |
| InChIKey | WGGVXXWGTWEANU-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.67 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|