C24H39N3O3 — CID 7230501
5-[[(2R)-2-ethylhexanoyl]amino]-N-(2-methoxyethyl)-2-(4-methylpiperidin-1-yl)benzamide (PubChem CID 7230501) has the molecular formula C24H39N3O3 and a molecular weight of 417.59 g/mol. Its IUPAC name is 5-[[(2R)-2-ethylhexanoyl]amino]-N-(2-methoxyethyl)-2-(4-methylpiperidin-1-yl)benzamide.
| Compound Name | 5-[[(2R)-2-ethylhexanoyl]amino]-N-(2-methoxyethyl)-2-(4-methylpiperidin-1-yl)benzamide |
|---|---|
| PubChem CID | 7230501 |
| Molecular Formula | C24H39N3O3 |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.30 |
| IUPAC Name | 5-[[(2R)-2-ethylhexanoyl]amino]-N-(2-methoxyethyl)-2-(4-methylpiperidin-1-yl)benzamide |
| SMILES | CCCC[C@@H](CC)C(=O)Nc1ccc(N2CCC(C)CC2)c(C(=O)NCCOC)c1 |
| InChI | InChI=1S/C24H39N3O3/c1-5-7-8-19(6-2)23(28)26-20-9-10-22(27-14-11-18(3)12-15-27)21(17-20)24(29)25-13-16-30-4/h9-10,17-19H,5-8,11-16H2,1-4H3,(H,25,29)(H,26,28)/t19-/m1/s1 |
| InChIKey | BRPQFYSGXIJNPY-LJQANCHMSA-N |
| XLogP | 4.45 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|