C26H43N3O3 — CID 5202151
5-(decanoylamino)-N-(2-methoxyethyl)-2-(4-methylpiperidin-1-yl)benzamide (PubChem CID 5202151) has the molecular formula C26H43N3O3 and a molecular weight of 445.65 g/mol. Its IUPAC name is 5-(decanoylamino)-N-(2-methoxyethyl)-2-(4-methylpiperidin-1-yl)benzamide.
| Compound Name | 5-(decanoylamino)-N-(2-methoxyethyl)-2-(4-methylpiperidin-1-yl)benzamide |
|---|---|
| PubChem CID | 5202151 |
| Molecular Formula | C26H43N3O3 |
| Molecular Weight | 445.65 g/mol |
| Exact Mass | 445.33 |
| IUPAC Name | 5-(decanoylamino)-N-(2-methoxyethyl)-2-(4-methylpiperidin-1-yl)benzamide |
| SMILES | CCCCCCCCCC(=O)Nc1ccc(N2CCC(C)CC2)c(C(=O)NCCOC)c1 |
| InChI | InChI=1S/C26H43N3O3/c1-4-5-6-7-8-9-10-11-25(30)28-22-12-13-24(29-17-14-21(2)15-18-29)23(20-22)26(31)27-16-19-32-3/h12-13,20-21H,4-11,14-19H2,1-3H3,(H,27,31)(H,28,30) |
| InChIKey | VMOFIEZJGMZOGR-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.65 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|